About 2-propyl-5H-thieno[2,3-b][1,5]benzoxazepin-4-one
2-propyl-5H-thieno[2,3-b][1,5]benzoxazepin-4-one (PubChem CID 18422310) has the molecular formula C14H13NO2S
and a molecular weight of 259.33 g/mol. Its IUPAC name is 2-propyl-5H-thieno[2,3-b][1,5]benzoxazepin-4-one.
Molecular Properties
| Compound Name | 2-propyl-5H-thieno[2,3-b][1,5]benzoxazepin-4-one |
| PubChem CID | 18422310 |
| Molecular Formula | C14H13NO2S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 2-propyl-5H-thieno[2,3-b][1,5]benzoxazepin-4-one |
| SMILES | CCCc1cc2c(s1)Oc1ccccc1NC2=O |
| InChI | InChI=1S/C14H13NO2S/c1-2-5-9-8-10-13(16)15-11-6-3-4-7-12(11)17-14(10)18-9/h3-4,6-8H,2,5H2,1H3,(H,15,16) |
| InChIKey | AXLBXTKRIZHQRE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-propyl-5H-thieno[2,3-b][1,5]benzoxazepin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyl-5H-thieno[2,3-b][1,5]benzoxazepin-4-one?
The IUPAC name of 2-propyl-5H-thieno[2,3-b][1,5]benzoxazepin-4-one (CID 18422310) is 2-propyl-5H-thieno[2,3-b][1,5]benzoxazepin-4-one.
What is the SMILES notation for 2-propyl-5H-thieno[2,3-b][1,5]benzoxazepin-4-one?
The canonical SMILES for 2-propyl-5H-thieno[2,3-b][1,5]benzoxazepin-4-one is CCCc1cc2c(s1)Oc1ccccc1NC2=O.
What is the InChIKey of 2-propyl-5H-thieno[2,3-b][1,5]benzoxazepin-4-one?
The InChIKey is AXLBXTKRIZHQRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO2S/c1-2-5-9-8-10-13(16)15-11-6-3-4-7-12(11)17-14(10)18-9/h3-4,6-8H,2,5H2,1H3,(H,15,16).
What are the key properties of 2-propyl-5H-thieno[2,3-b][1,5]benzoxazepin-4-one?
2-propyl-5H-thieno[2,3-b][1,5]benzoxazepin-4-one has a molecular weight of 259.33 g/mol, XLogP of 4.06, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyl-5H-thieno[2,3-b][1,5]benzoxazepin-4-one is sourced from PubChem (CID 18422310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).