C27H24N4O2 — CID 18422479
1-[1-(1H-imidazol-5-ylmethyl)-7-phenyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl]-2-phenylethane-1,2-dione (PubChem CID 18422479) has the molecular formula C27H24N4O2 and a molecular weight of 436.52 g/mol. Its IUPAC name is 1-[1-(1H-imidazol-5-ylmethyl)-7-phenyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl]-2-phenylethane-1,2-dione.
| Compound Name | 1-[1-(1H-imidazol-5-ylmethyl)-7-phenyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl]-2-phenylethane-1,2-dione |
|---|---|
| PubChem CID | 18422479 |
| Molecular Formula | C27H24N4O2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 1-[1-(1H-imidazol-5-ylmethyl)-7-phenyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl]-2-phenylethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCN(Cc2cnc[nH]2)c2ccc(-c3ccccc3)cc2C1)c1ccccc1 |
| InChI | InChI=1S/C27H24N4O2/c32-26(21-9-5-2-6-10-21)27(33)31-14-13-30(18-24-16-28-19-29-24)25-12-11-22(15-23(25)17-31)20-7-3-1-4-8-20/h1-12,15-16,19H,13-14,17-18H2,(H,28,29) |
| InChIKey | WMLQZSHIBQXSJX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|