About 1-[4-[[4-(2,4-difluorophenyl)piperazin-1-yl]methyl]phenyl]cyclopropane-1-carboxylic acid
1-[4-[[4-(2,4-difluorophenyl)piperazin-1-yl]methyl]phenyl]cyclopropane-1-carboxylic acid (PubChem CID 18423009) has the molecular formula C21H22F2N2O2
and a molecular weight of 372.42 g/mol. Its IUPAC name is 1-[4-[[4-(2,4-difluorophenyl)piperazin-1-yl]methyl]phenyl]cyclopropane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-[4-[[4-(2,4-difluorophenyl)piperazin-1-yl]methyl]phenyl]cyclopropane-1-carboxylic acid |
| PubChem CID | 18423009 |
| Molecular Formula | C21H22F2N2O2 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 1-[4-[[4-(2,4-difluorophenyl)piperazin-1-yl]methyl]phenyl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2ccc(CN3CCN(c4ccc(F)cc4F)CC3)cc2)CC1 |
| InChI | InChI=1S/C21H22F2N2O2/c22-17-5-6-19(18(23)13-17)25-11-9-24(10-12-25)14-15-1-3-16(4-2-15)21(7-8-21)20(26)27/h1-6,13H,7-12,14H2,(H,26,27) |
| InChIKey | VNGSMXLQDXASJQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[4-[[4-(2,4-difluorophenyl)piperazin-1-yl]methyl]phenyl]cyclopropane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[[4-(2,4-difluorophenyl)piperazin-1-yl]methyl]phenyl]cyclopropane-1-carboxylic acid?
The IUPAC name of 1-[4-[[4-(2,4-difluorophenyl)piperazin-1-yl]methyl]phenyl]cyclopropane-1-carboxylic acid (CID 18423009) is 1-[4-[[4-(2,4-difluorophenyl)piperazin-1-yl]methyl]phenyl]cyclopropane-1-carboxylic acid.
What is the SMILES notation for 1-[4-[[4-(2,4-difluorophenyl)piperazin-1-yl]methyl]phenyl]cyclopropane-1-carboxylic acid?
The canonical SMILES for 1-[4-[[4-(2,4-difluorophenyl)piperazin-1-yl]methyl]phenyl]cyclopropane-1-carboxylic acid is O=C(O)C1(c2ccc(CN3CCN(c4ccc(F)cc4F)CC3)cc2)CC1.
What is the InChIKey of 1-[4-[[4-(2,4-difluorophenyl)piperazin-1-yl]methyl]phenyl]cyclopropane-1-carboxylic acid?
The InChIKey is VNGSMXLQDXASJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22F2N2O2/c22-17-5-6-19(18(23)13-17)25-11-9-24(10-12-25)14-15-1-3-16(4-2-15)21(7-8-21)20(26)27/h1-6,13H,7-12,14H2,(H,26,27).
What are the key properties of 1-[4-[[4-(2,4-difluorophenyl)piperazin-1-yl]methyl]phenyl]cyclopropane-1-carboxylic acid?
1-[4-[[4-(2,4-difluorophenyl)piperazin-1-yl]methyl]phenyl]cyclopropane-1-carboxylic acid has a molecular weight of 372.42 g/mol, XLogP of 3.40, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[[4-(2,4-difluorophenyl)piperazin-1-yl]methyl]phenyl]cyclopropane-1-carboxylic acid is sourced from PubChem (CID 18423009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).