C15H29NO3 — CID 18423469
tert-butyl 4-(2-hydroxypentyl)piperidine-1-carboxylate (PubChem CID 18423469) has the molecular formula C15H29NO3 and a molecular weight of 271.40 g/mol. Its IUPAC name is tert-butyl 4-(2-hydroxypentyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-hydroxypentyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 18423469 |
| Molecular Formula | C15H29NO3 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.21 |
| IUPAC Name | tert-butyl 4-(2-hydroxypentyl)piperidine-1-carboxylate |
| SMILES | CCCC(O)CC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H29NO3/c1-5-6-13(17)11-12-7-9-16(10-8-12)14(18)19-15(2,3)4/h12-13,17H,5-11H2,1-4H3 |
| InChIKey | YMZPBUBCSWDNLL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |