C24H34N4O4 — CID 18423591
2-[1-[[3-[4-(2,6-dimethylmorpholine-4-carboximidoyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]piperidin-4-yl]acetic acid (PubChem CID 18423591) has the molecular formula C24H34N4O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is 2-[1-[[3-[4-(2,6-dimethylmorpholine-4-carboximidoyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[1-[[3-[4-(2,6-dimethylmorpholine-4-carboximidoyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 18423591 |
| Molecular Formula | C24H34N4O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 2-[1-[[3-[4-(2,6-dimethylmorpholine-4-carboximidoyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]piperidin-4-yl]acetic acid |
| SMILES | [H]/N=C(/c1ccc(C2=NOC(CN3CCC(CC(=O)O)CC3)C2)cc1)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C24H34N4O4/c1-16-13-28(14-17(2)31-16)24(25)20-5-3-19(4-6-20)22-12-21(32-26-22)15-27-9-7-18(8-10-27)11-23(29)30/h3-6,16-18,21,25H,7-15H2,1-2H3,(H,29,30)/b25-24- |
| InChIKey | ZYEXVRFCBPZSGJ-IZHYLOQSSA-N |
| XLogP | 2.80 |
| TPSA | 98.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|