About 1-(1-benzylpyrrol-2-yl)-N,N-dimethylmethanamine;iodomethane
1-(1-benzylpyrrol-2-yl)-N,N-dimethylmethanamine;iodomethane (PubChem CID 18424249) has the molecular formula C15H21IN2
and a molecular weight of 356.25 g/mol. Its IUPAC name is 1-(1-benzylpyrrol-2-yl)-N,N-dimethylmethanamine;iodomethane.
Molecular Properties
| Compound Name | 1-(1-benzylpyrrol-2-yl)-N,N-dimethylmethanamine;iodomethane |
| PubChem CID | 18424249 |
| Molecular Formula | C15H21IN2 |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 1-(1-benzylpyrrol-2-yl)-N,N-dimethylmethanamine;iodomethane |
| SMILES | CI.CN(C)Cc1cccn1Cc1ccccc1 |
| InChI | InChI=1S/C14H18N2.CH3I/c1-15(2)12-14-9-6-10-16(14)11-13-7-4-3-5-8-13;1-2/h3-10H,11-12H2,1-2H3;1H3 |
| InChIKey | NUWNJOMJJTUNNK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-benzylpyrrol-2-yl)-N,N-dimethylmethanamine;iodomethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-benzylpyrrol-2-yl)-N,N-dimethylmethanamine;iodomethane?
The IUPAC name of 1-(1-benzylpyrrol-2-yl)-N,N-dimethylmethanamine;iodomethane (CID 18424249) is 1-(1-benzylpyrrol-2-yl)-N,N-dimethylmethanamine;iodomethane.
What is the SMILES notation for 1-(1-benzylpyrrol-2-yl)-N,N-dimethylmethanamine;iodomethane?
The canonical SMILES for 1-(1-benzylpyrrol-2-yl)-N,N-dimethylmethanamine;iodomethane is CI.CN(C)Cc1cccn1Cc1ccccc1.
What is the InChIKey of 1-(1-benzylpyrrol-2-yl)-N,N-dimethylmethanamine;iodomethane?
The InChIKey is NUWNJOMJJTUNNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2.CH3I/c1-15(2)12-14-9-6-10-16(14)11-13-7-4-3-5-8-13;1-2/h3-10H,11-12H2,1-2H3;1H3.
What are the key properties of 1-(1-benzylpyrrol-2-yl)-N,N-dimethylmethanamine;iodomethane?
1-(1-benzylpyrrol-2-yl)-N,N-dimethylmethanamine;iodomethane has a molecular weight of 356.25 g/mol, XLogP of 3.65, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-benzylpyrrol-2-yl)-N,N-dimethylmethanamine;iodomethane is sourced from PubChem (CID 18424249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).