About phenanthren-9-yl methanesulfonate
phenanthren-9-yl methanesulfonate (PubChem CID 18424515) has the molecular formula C15H12O3S
and a molecular weight of 272.33 g/mol. Its IUPAC name is phenanthren-9-yl methanesulfonate.
Molecular Properties
| Compound Name | phenanthren-9-yl methanesulfonate |
| PubChem CID | 18424515 |
| Molecular Formula | C15H12O3S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | phenanthren-9-yl methanesulfonate |
| SMILES | CS(=O)(=O)Oc1cc2ccccc2c2ccccc12 |
| InChI | InChI=1S/C15H12O3S/c1-19(16,17)18-15-10-11-6-2-3-7-12(11)13-8-4-5-9-14(13)15/h2-10H,1H3 |
| InChIKey | XTTWKFFJJPFKDT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze phenanthren-9-yl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenanthren-9-yl methanesulfonate?
The IUPAC name of phenanthren-9-yl methanesulfonate (CID 18424515) is phenanthren-9-yl methanesulfonate.
What is the SMILES notation for phenanthren-9-yl methanesulfonate?
The canonical SMILES for phenanthren-9-yl methanesulfonate is CS(=O)(=O)Oc1cc2ccccc2c2ccccc12.
What is the InChIKey of phenanthren-9-yl methanesulfonate?
The InChIKey is XTTWKFFJJPFKDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O3S/c1-19(16,17)18-15-10-11-6-2-3-7-12(11)13-8-4-5-9-14(13)15/h2-10H,1H3.
What are the key properties of phenanthren-9-yl methanesulfonate?
phenanthren-9-yl methanesulfonate has a molecular weight of 272.33 g/mol, XLogP of 3.33, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenanthren-9-yl methanesulfonate is sourced from PubChem (CID 18424515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).