C21H25Cl5N6O4 — CID 18424631
2-[4-[2-(4-amino-3,5-dichloro-N-hydroxyanilino)-2-oxoethyl]-4-methylpiperazin-4-ium-1-yl]-N-(4-amino-3,5-dichlorophenyl)-N-hydroxyacetamide chloride (PubChem CID 18424631) has the molecular formula C21H25Cl5N6O4 and a molecular weight of 602.73 g/mol. Its IUPAC name is 2-[4-[2-(4-amino-3,5-dichloro-N-hydroxyanilino)-2-oxoethyl]-4-methylpiperazin-4-ium-1-yl]-N-(4-amino-3,5-dichlorophenyl)-N-hydroxyacetamide chloride.
| Compound Name | 2-[4-[2-(4-amino-3,5-dichloro-N-hydroxyanilino)-2-oxoethyl]-4-methylpiperazin-4-ium-1-yl]-N-(4-amino-3,5-dichlorophenyl)-N-hydroxyacetamide chloride |
|---|---|
| PubChem CID | 18424631 |
| Molecular Formula | C21H25Cl5N6O4 |
| Molecular Weight | 602.73 g/mol |
| Exact Mass | 600.04 |
| IUPAC Name | 2-[4-[2-(4-amino-3,5-dichloro-N-hydroxyanilino)-2-oxoethyl]-4-methylpiperazin-4-ium-1-yl]-N-(4-amino-3,5-dichlorophenyl)-N-hydroxyacetamide chloride |
| SMILES | C[N+]1(CC(=O)N(O)c2cc(Cl)c(N)c(Cl)c2)CCN(CC(=O)N(O)c2cc(Cl)c(N)c(Cl)c2)CC1.[Cl-] |
| InChI | InChI=1S/C21H25Cl4N6O4.ClH/c1-31(11-19(33)30(35)13-8-16(24)21(27)17(25)9-13)4-2-28(3-5-31)10-18(32)29(34)12-6-14(22)20(26)15(23)7-12;/h6-9,34-35H,2-5,10-11,26-27H2,1H3;1H/q+1;/p-1 |
| InChIKey | QGTQBMXDFURJGT-UHFFFAOYSA-M |
| XLogP | 0.38 |
| TPSA | 136.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.73 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|