About adamantane;oxolane-2,5-dione
adamantane;oxolane-2,5-dione (PubChem CID 18424860) has the molecular formula C14H20O3
and a molecular weight of 236.31 g/mol. Its IUPAC name is adamantane;oxolane-2,5-dione.
Molecular Properties
| Compound Name | adamantane;oxolane-2,5-dione |
| PubChem CID | 18424860 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | adamantane;oxolane-2,5-dione |
| SMILES | C1C2CC3CC1CC(C2)C3.O=C1CCC(=O)O1 |
| InChI | InChI=1S/C10H16.C4H4O3/c1-7-2-9-4-8(1)5-10(3-7)6-9;5-3-1-2-4(6)7-3/h7-10H,1-6H2;1-2H2 |
| InChIKey | ZMKHPUPFOMEMFU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze adamantane;oxolane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane;oxolane-2,5-dione?
The IUPAC name of adamantane;oxolane-2,5-dione (CID 18424860) is adamantane;oxolane-2,5-dione.
What is the SMILES notation for adamantane;oxolane-2,5-dione?
The canonical SMILES for adamantane;oxolane-2,5-dione is C1C2CC3CC1CC(C2)C3.O=C1CCC(=O)O1.
What is the InChIKey of adamantane;oxolane-2,5-dione?
The InChIKey is ZMKHPUPFOMEMFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16.C4H4O3/c1-7-2-9-4-8(1)5-10(3-7)6-9;5-3-1-2-4(6)7-3/h7-10H,1-6H2;1-2H2.
What are the key properties of adamantane;oxolane-2,5-dione?
adamantane;oxolane-2,5-dione has a molecular weight of 236.31 g/mol, XLogP of 2.68, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane;oxolane-2,5-dione is sourced from PubChem (CID 18424860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).