About 5-prop-2-enyl-10H-indeno[1,2-b]indole
5-prop-2-enyl-10H-indeno[1,2-b]indole (PubChem CID 18424932) has the molecular formula C18H15N
and a molecular weight of 245.33 g/mol. Its IUPAC name is 5-prop-2-enyl-10H-indeno[1,2-b]indole.
Molecular Properties
| Compound Name | 5-prop-2-enyl-10H-indeno[1,2-b]indole |
| PubChem CID | 18424932 |
| Molecular Formula | C18H15N |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 5-prop-2-enyl-10H-indeno[1,2-b]indole |
| SMILES | C=CCn1c2c(c3ccccc31)Cc1ccccc1-2 |
| InChI | InChI=1S/C18H15N/c1-2-11-19-17-10-6-5-9-15(17)16-12-13-7-3-4-8-14(13)18(16)19/h2-10H,1,11-12H2 |
| InChIKey | BDWNLVWLRYTBJR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-prop-2-enyl-10H-indeno[1,2-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-prop-2-enyl-10H-indeno[1,2-b]indole?
The IUPAC name of 5-prop-2-enyl-10H-indeno[1,2-b]indole (CID 18424932) is 5-prop-2-enyl-10H-indeno[1,2-b]indole.
What is the SMILES notation for 5-prop-2-enyl-10H-indeno[1,2-b]indole?
The canonical SMILES for 5-prop-2-enyl-10H-indeno[1,2-b]indole is C=CCn1c2c(c3ccccc31)Cc1ccccc1-2.
What is the InChIKey of 5-prop-2-enyl-10H-indeno[1,2-b]indole?
The InChIKey is BDWNLVWLRYTBJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N/c1-2-11-19-17-10-6-5-9-15(17)16-12-13-7-3-4-8-14(13)18(16)19/h2-10H,1,11-12H2.
What are the key properties of 5-prop-2-enyl-10H-indeno[1,2-b]indole?
5-prop-2-enyl-10H-indeno[1,2-b]indole has a molecular weight of 245.33 g/mol, XLogP of 4.40, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-prop-2-enyl-10H-indeno[1,2-b]indole is sourced from PubChem (CID 18424932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).