About 1-benzhydrylpiperidin-4-amine;cyclobutane
1-benzhydrylpiperidin-4-amine;cyclobutane (PubChem CID 18425735) has the molecular formula C22H30N2
and a molecular weight of 322.50 g/mol. Its IUPAC name is 1-benzhydrylpiperidin-4-amine;cyclobutane.
Molecular Properties
| Compound Name | 1-benzhydrylpiperidin-4-amine;cyclobutane |
| PubChem CID | 18425735 |
| Molecular Formula | C22H30N2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | 1-benzhydrylpiperidin-4-amine;cyclobutane |
| SMILES | C1CCC1.NC1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H22N2.C4H8/c19-17-11-13-20(14-12-17)18(15-7-3-1-4-8-15)16-9-5-2-6-10-16;1-2-4-3-1/h1-10,17-18H,11-14,19H2;1-4H2 |
| InChIKey | FXQKWFJDKUPUHY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzhydrylpiperidin-4-amine;cyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzhydrylpiperidin-4-amine;cyclobutane?
The IUPAC name of 1-benzhydrylpiperidin-4-amine;cyclobutane (CID 18425735) is 1-benzhydrylpiperidin-4-amine;cyclobutane.
What is the SMILES notation for 1-benzhydrylpiperidin-4-amine;cyclobutane?
The canonical SMILES for 1-benzhydrylpiperidin-4-amine;cyclobutane is C1CCC1.NC1CCN(C(c2ccccc2)c2ccccc2)CC1.
What is the InChIKey of 1-benzhydrylpiperidin-4-amine;cyclobutane?
The InChIKey is FXQKWFJDKUPUHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2.C4H8/c19-17-11-13-20(14-12-17)18(15-7-3-1-4-8-15)16-9-5-2-6-10-16;1-2-4-3-1/h1-10,17-18H,11-14,19H2;1-4H2.
What are the key properties of 1-benzhydrylpiperidin-4-amine;cyclobutane?
1-benzhydrylpiperidin-4-amine;cyclobutane has a molecular weight of 322.50 g/mol, XLogP of 4.76, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzhydrylpiperidin-4-amine;cyclobutane is sourced from PubChem (CID 18425735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).