C21H22F2N6O3 — CID 18426218
2-amino-N-[2-[[1-(2,1,3-benzoxadiazol-5-yl)piperidin-4-yl]methylamino]-2-oxoethyl]-4,5-difluorobenzamide (PubChem CID 18426218) has the molecular formula C21H22F2N6O3 and a molecular weight of 444.44 g/mol. Its IUPAC name is 2-amino-N-[2-[[1-(2,1,3-benzoxadiazol-5-yl)piperidin-4-yl]methylamino]-2-oxoethyl]-4,5-difluorobenzamide.
| Compound Name | 2-amino-N-[2-[[1-(2,1,3-benzoxadiazol-5-yl)piperidin-4-yl]methylamino]-2-oxoethyl]-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 18426218 |
| Molecular Formula | C21H22F2N6O3 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 2-amino-N-[2-[[1-(2,1,3-benzoxadiazol-5-yl)piperidin-4-yl]methylamino]-2-oxoethyl]-4,5-difluorobenzamide |
| SMILES | Nc1cc(F)c(F)cc1C(=O)NCC(=O)NCC1CCN(c2ccc3nonc3c2)CC1 |
| InChI | InChI=1S/C21H22F2N6O3/c22-15-8-14(17(24)9-16(15)23)21(31)26-11-20(30)25-10-12-3-5-29(6-4-12)13-1-2-18-19(7-13)28-32-27-18/h1-2,7-9,12H,3-6,10-11,24H2,(H,25,30)(H,26,31) |
| InChIKey | GQGTWUQBSZJAAM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 126.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|