2-[4-(4-chlorophenyl)-3-methylphenyl]propanoyl chloride

C16H14Cl2O — CID 18426294

IUPAC2-[4-(4-chlorophenyl)-3-methylphenyl]propanoyl chloride
SMILESCc1cc(C(C)C(=O)Cl)ccc1-c1ccc(Cl)cc1
InChIInChI=1S/C16H14Cl2O/c1-10-9-13(11(2)16(18)19)5-8-15(10)12-3-6-14(17)7-4-12/h3-9,11H,1-2H3
InChIKeyYGMXTRWBPQJHMH-UHFFFAOYSA-N
MW293.19 g/mol
LogP5.18
Rot. Bonds3

About 2-[4-(4-chlorophenyl)-3-methylphenyl]propanoyl chloride

2-[4-(4-chlorophenyl)-3-methylphenyl]propanoyl chloride (PubChem CID 18426294) has the molecular formula C16H14Cl2O and a molecular weight of 293.19 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)-3-methylphenyl]propanoyl chloride.

Molecular Properties

Compound Name2-[4-(4-chlorophenyl)-3-methylphenyl]propanoyl chloride
PubChem CID18426294
Molecular FormulaC16H14Cl2O
Molecular Weight293.19 g/mol
Exact Mass292.04
IUPAC Name2-[4-(4-chlorophenyl)-3-methylphenyl]propanoyl chloride
SMILESCc1cc(C(C)C(=O)Cl)ccc1-c1ccc(Cl)cc1
InChIInChI=1S/C16H14Cl2O/c1-10-9-13(11(2)16(18)19)5-8-15(10)12-3-6-14(17)7-4-12/h3-9,11H,1-2H3
InChIKeyYGMXTRWBPQJHMH-UHFFFAOYSA-N
XLogP5.18
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500293.19
LogP ≤ 55.18
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2-[4-(4-chlorophenyl)-3-methylphenyl]propanoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-(4-chlorophenyl)-3-methylphenyl]propanoyl chloride?
The IUPAC name of 2-[4-(4-chlorophenyl)-3-methylphenyl]propanoyl chloride (CID 18426294) is 2-[4-(4-chlorophenyl)-3-methylphenyl]propanoyl chloride.
What is the SMILES notation for 2-[4-(4-chlorophenyl)-3-methylphenyl]propanoyl chloride?
The canonical SMILES for 2-[4-(4-chlorophenyl)-3-methylphenyl]propanoyl chloride is Cc1cc(C(C)C(=O)Cl)ccc1-c1ccc(Cl)cc1.
What is the InChIKey of 2-[4-(4-chlorophenyl)-3-methylphenyl]propanoyl chloride?
The InChIKey is YGMXTRWBPQJHMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14Cl2O/c1-10-9-13(11(2)16(18)19)5-8-15(10)12-3-6-14(17)7-4-12/h3-9,11H,1-2H3.
What are the key properties of 2-[4-(4-chlorophenyl)-3-methylphenyl]propanoyl chloride?
2-[4-(4-chlorophenyl)-3-methylphenyl]propanoyl chloride has a molecular weight of 293.19 g/mol, XLogP of 5.18, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-chlorophenyl)-3-methylphenyl]propanoyl chloride is sourced from PubChem (CID 18426294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).