About cyclopenta-1,3-diene-1,2,3-triamine
cyclopenta-1,3-diene-1,2,3-triamine (PubChem CID 18426458) has the molecular formula C5H9N3
and a molecular weight of 111.15 g/mol. Its IUPAC name is cyclopenta-1,3-diene-1,2,3-triamine.
Molecular Properties
| Compound Name | cyclopenta-1,3-diene-1,2,3-triamine |
| PubChem CID | 18426458 |
| Molecular Formula | C5H9N3 |
| Molecular Weight | 111.15 g/mol |
| Exact Mass | 111.08 |
| IUPAC Name | cyclopenta-1,3-diene-1,2,3-triamine |
| SMILES | NC1=CCC(N)=C1N |
| InChI | InChI=1S/C5H9N3/c6-3-1-2-4(7)5(3)8/h1H,2,6-8H2 |
| InChIKey | IXCLMMGXQXBSMT-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.15 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclopenta-1,3-diene-1,2,3-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,3-diene-1,2,3-triamine?
The IUPAC name of cyclopenta-1,3-diene-1,2,3-triamine (CID 18426458) is cyclopenta-1,3-diene-1,2,3-triamine.
What is the SMILES notation for cyclopenta-1,3-diene-1,2,3-triamine?
The canonical SMILES for cyclopenta-1,3-diene-1,2,3-triamine is NC1=CCC(N)=C1N.
What is the InChIKey of cyclopenta-1,3-diene-1,2,3-triamine?
The InChIKey is IXCLMMGXQXBSMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3/c6-3-1-2-4(7)5(3)8/h1H,2,6-8H2.
What are the key properties of cyclopenta-1,3-diene-1,2,3-triamine?
cyclopenta-1,3-diene-1,2,3-triamine has a molecular weight of 111.15 g/mol, XLogP of -0.64, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3-diene-1,2,3-triamine is sourced from PubChem (CID 18426458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).