C8H13N — CID 18426479
2,3,3a,4,5,7a-hexahydro-1H-indole (PubChem CID 18426479) has the molecular formula C8H13N and a molecular weight of 123.20 g/mol. Its IUPAC name is 2,3,3a,4,5,7a-hexahydro-1H-indole.
| Compound Name | 2,3,3a,4,5,7a-hexahydro-1H-indole |
|---|---|
| PubChem CID | 18426479 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | 2,3,3a,4,5,7a-hexahydro-1H-indole |
| SMILES | C1=CC2NCCC2CC1 |
| InChI | InChI=1S/C8H13N/c1-2-4-8-7(3-1)5-6-9-8/h2,4,7-9H,1,3,5-6H2 |
| InChIKey | MFOUWLGLIHXCOZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|