About 7-amino-4-carbamoyl-4-(3,4-dichlorophenyl)-7-oxoheptanoic acid
7-amino-4-carbamoyl-4-(3,4-dichlorophenyl)-7-oxoheptanoic acid (PubChem CID 18426773) has the molecular formula C14H16Cl2N2O4
and a molecular weight of 347.20 g/mol. Its IUPAC name is 7-amino-4-carbamoyl-4-(3,4-dichlorophenyl)-7-oxoheptanoic acid.
Molecular Properties
| Compound Name | 7-amino-4-carbamoyl-4-(3,4-dichlorophenyl)-7-oxoheptanoic acid |
| PubChem CID | 18426773 |
| Molecular Formula | C14H16Cl2N2O4 |
| Molecular Weight | 347.20 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 7-amino-4-carbamoyl-4-(3,4-dichlorophenyl)-7-oxoheptanoic acid |
| SMILES | NC(=O)CCC(CCC(=O)O)(C(N)=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H16Cl2N2O4/c15-9-2-1-8(7-10(9)16)14(13(18)22,5-3-11(17)19)6-4-12(20)21/h1-2,7H,3-6H2,(H2,17,19)(H2,18,22)(H,20,21) |
| InChIKey | HGRPCIWLWYZXQN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 123.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.20 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-amino-4-carbamoyl-4-(3,4-dichlorophenyl)-7-oxoheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-4-carbamoyl-4-(3,4-dichlorophenyl)-7-oxoheptanoic acid?
The IUPAC name of 7-amino-4-carbamoyl-4-(3,4-dichlorophenyl)-7-oxoheptanoic acid (CID 18426773) is 7-amino-4-carbamoyl-4-(3,4-dichlorophenyl)-7-oxoheptanoic acid.
What is the SMILES notation for 7-amino-4-carbamoyl-4-(3,4-dichlorophenyl)-7-oxoheptanoic acid?
The canonical SMILES for 7-amino-4-carbamoyl-4-(3,4-dichlorophenyl)-7-oxoheptanoic acid is NC(=O)CCC(CCC(=O)O)(C(N)=O)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 7-amino-4-carbamoyl-4-(3,4-dichlorophenyl)-7-oxoheptanoic acid?
The InChIKey is HGRPCIWLWYZXQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16Cl2N2O4/c15-9-2-1-8(7-10(9)16)14(13(18)22,5-3-11(17)19)6-4-12(20)21/h1-2,7H,3-6H2,(H2,17,19)(H2,18,22)(H,20,21).
What are the key properties of 7-amino-4-carbamoyl-4-(3,4-dichlorophenyl)-7-oxoheptanoic acid?
7-amino-4-carbamoyl-4-(3,4-dichlorophenyl)-7-oxoheptanoic acid has a molecular weight of 347.20 g/mol, XLogP of 1.85, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-4-carbamoyl-4-(3,4-dichlorophenyl)-7-oxoheptanoic acid is sourced from PubChem (CID 18426773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).