About (2-chlorophenyl)iodanium
(2-chlorophenyl)iodanium (PubChem CID 18427197) has the molecular formula C6H5ClI+
and a molecular weight of 239.46 g/mol. Its IUPAC name is (2-chlorophenyl)iodanium.
Molecular Properties
| Compound Name | (2-chlorophenyl)iodanium |
| PubChem CID | 18427197 |
| Molecular Formula | C6H5ClI+ |
| Molecular Weight | 239.46 g/mol |
| Exact Mass | 238.91 |
| IUPAC Name | (2-chlorophenyl)iodanium |
| SMILES | Clc1ccccc1[IH+] |
| InChI | InChI=1S/C6H5ClI/c7-5-3-1-2-4-6(5)8/h1-4,8H/q+1 |
| InChIKey | SKHORTQQMOJOSW-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.46 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2-chlorophenyl)iodanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chlorophenyl)iodanium?
The IUPAC name of (2-chlorophenyl)iodanium (CID 18427197) is (2-chlorophenyl)iodanium.
What is the SMILES notation for (2-chlorophenyl)iodanium?
The canonical SMILES for (2-chlorophenyl)iodanium is Clc1ccccc1[IH+].
What is the InChIKey of (2-chlorophenyl)iodanium?
The InChIKey is SKHORTQQMOJOSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClI/c7-5-3-1-2-4-6(5)8/h1-4,8H/q+1.
What are the key properties of (2-chlorophenyl)iodanium?
(2-chlorophenyl)iodanium has a molecular weight of 239.46 g/mol, XLogP of -1.20, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chlorophenyl)iodanium is sourced from PubChem (CID 18427197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).