About 1,3,5,6-tetramethoxy-1H-indene
1,3,5,6-tetramethoxy-1H-indene (PubChem CID 18427629) has the molecular formula C13H16O4
and a molecular weight of 236.27 g/mol. Its IUPAC name is 1,3,5,6-tetramethoxy-1H-indene.
Molecular Properties
| Compound Name | 1,3,5,6-tetramethoxy-1H-indene |
| PubChem CID | 18427629 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 1,3,5,6-tetramethoxy-1H-indene |
| SMILES | COC1=CC(OC)c2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C13H16O4/c1-14-10-7-11(15-2)9-6-13(17-4)12(16-3)5-8(9)10/h5-7,10H,1-4H3 |
| InChIKey | QVRKSLOJKQRBAU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,3,5,6-tetramethoxy-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,5,6-tetramethoxy-1H-indene?
The IUPAC name of 1,3,5,6-tetramethoxy-1H-indene (CID 18427629) is 1,3,5,6-tetramethoxy-1H-indene.
What is the SMILES notation for 1,3,5,6-tetramethoxy-1H-indene?
The canonical SMILES for 1,3,5,6-tetramethoxy-1H-indene is COC1=CC(OC)c2cc(OC)c(OC)cc21.
What is the InChIKey of 1,3,5,6-tetramethoxy-1H-indene?
The InChIKey is QVRKSLOJKQRBAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O4/c1-14-10-7-11(15-2)9-6-13(17-4)12(16-3)5-8(9)10/h5-7,10H,1-4H3.
What are the key properties of 1,3,5,6-tetramethoxy-1H-indene?
1,3,5,6-tetramethoxy-1H-indene has a molecular weight of 236.27 g/mol, XLogP of 2.39, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,5,6-tetramethoxy-1H-indene is sourced from PubChem (CID 18427629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).