About 2-(piperazin-2-yl)-1H-1,3-benzodiazole-4-carboxamide
2-(piperazin-2-yl)-1H-1,3-benzodiazole-4-carboxamide (PubChem CID 18428022) has the molecular formula C12H15N5O
and a molecular weight of 245.28 g/mol. Its IUPAC name is 2-piperazin-2-yl-1H-benzimidazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-(piperazin-2-yl)-1H-1,3-benzodiazole-4-carboxamide |
| PubChem CID | 18428022 |
| Molecular Formula | C12H15N5O |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 2-piperazin-2-yl-1H-benzimidazole-4-carboxamide |
| SMILES | C1CNC(CN1)C2=NC3=C(C=CC=C3N2)C(=O)N |
| InChI | InChI=1S/C12H15N5O/c13-11(18)7-2-1-3-8-10(7)17-12(16-8)9-6-14-4-5-15-9/h1-3,9,14-15H,4-6H2,(H2,13,18)(H,16,17) |
| InChIKey | PNRIMHRPMGAVEB-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 95.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | 324 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(piperazin-2-yl)-1H-1,3-benzodiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(piperazin-2-yl)-1H-1,3-benzodiazole-4-carboxamide?
The IUPAC name of 2-(piperazin-2-yl)-1H-1,3-benzodiazole-4-carboxamide (CID 18428022) is 2-piperazin-2-yl-1H-benzimidazole-4-carboxamide.
What is the SMILES notation for 2-(piperazin-2-yl)-1H-1,3-benzodiazole-4-carboxamide?
The canonical SMILES for 2-(piperazin-2-yl)-1H-1,3-benzodiazole-4-carboxamide is C1CNC(CN1)C2=NC3=C(C=CC=C3N2)C(=O)N.
What is the InChIKey of 2-(piperazin-2-yl)-1H-1,3-benzodiazole-4-carboxamide?
The InChIKey is PNRIMHRPMGAVEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N5O/c13-11(18)7-2-1-3-8-10(7)17-12(16-8)9-6-14-4-5-15-9/h1-3,9,14-15H,4-6H2,(H2,13,18)(H,16,17).
What are the key properties of 2-(piperazin-2-yl)-1H-1,3-benzodiazole-4-carboxamide?
2-(piperazin-2-yl)-1H-1,3-benzodiazole-4-carboxamide has a molecular weight of 245.28 g/mol, XLogP of -0.90, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(piperazin-2-yl)-1H-1,3-benzodiazole-4-carboxamide is sourced from PubChem (CID 18428022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).