C14H21IN2O — CID 18428438
N-[2-(4-methoxyphenyl)ethyl]-2,3,4,5-tetrahydropyridin-6-amine;hydroiodide (PubChem CID 18428438) has the molecular formula C14H21IN2O and a molecular weight of 360.24 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)ethyl]-2,3,4,5-tetrahydropyridin-6-amine;hydroiodide.
| Compound Name | N-[2-(4-methoxyphenyl)ethyl]-2,3,4,5-tetrahydropyridin-6-amine;hydroiodide |
|---|---|
| PubChem CID | 18428438 |
| Molecular Formula | C14H21IN2O |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | N-[2-(4-methoxyphenyl)ethyl]-2,3,4,5-tetrahydropyridin-6-amine;hydroiodide |
| SMILES | COc1ccc(CCNC2=NCCCC2)cc1.I |
| InChI | InChI=1S/C14H20N2O.HI/c1-17-13-7-5-12(6-8-13)9-11-16-14-4-2-3-10-15-14;/h5-8H,2-4,9-11H2,1H3,(H,15,16);1H |
| InChIKey | BJFHEUVVDUPGGN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|