About 2,3,4,5-tetrahydropyridine-3,6-diamine;hydrochloride
2,3,4,5-tetrahydropyridine-3,6-diamine;hydrochloride (PubChem CID 18428459) has the molecular formula C5H12ClN3
and a molecular weight of 149.62 g/mol. Its IUPAC name is 2,3,4,5-tetrahydropyridine-3,6-diamine;hydrochloride.
Analyze 2,3,4,5-tetrahydropyridine-3,6-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4,5-tetrahydropyridine-3,6-diamine;hydrochloride?
The IUPAC name of 2,3,4,5-tetrahydropyridine-3,6-diamine;hydrochloride (CID 18428459) is 2,3,4,5-tetrahydropyridine-3,6-diamine;hydrochloride.
What is the SMILES notation for 2,3,4,5-tetrahydropyridine-3,6-diamine;hydrochloride?
The canonical SMILES for 2,3,4,5-tetrahydropyridine-3,6-diamine;hydrochloride is Cl.NC1=NCC(N)CC1.
What is the InChIKey of 2,3,4,5-tetrahydropyridine-3,6-diamine;hydrochloride?
The InChIKey is LTKBUZBNIMUHMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N3.ClH/c6-4-1-2-5(7)8-3-4;/h4H,1-3,6H2,(H2,7,8);1H.
What are the key properties of 2,3,4,5-tetrahydropyridine-3,6-diamine;hydrochloride?
2,3,4,5-tetrahydropyridine-3,6-diamine;hydrochloride has a molecular weight of 149.62 g/mol, XLogP of -0.11, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4,5-tetrahydropyridine-3,6-diamine;hydrochloride is sourced from PubChem (CID 18428459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).