About 2-methoxy-4,5-dihydro-3H-1-benzazepine
2-methoxy-4,5-dihydro-3H-1-benzazepine (PubChem CID 18428530) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is 2-methoxy-4,5-dihydro-3H-1-benzazepine.
Molecular Properties
| Compound Name | 2-methoxy-4,5-dihydro-3H-1-benzazepine |
| PubChem CID | 18428530 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 2-methoxy-4,5-dihydro-3H-1-benzazepine |
| SMILES | COC1=Nc2ccccc2CCC1 |
| InChI | InChI=1S/C11H13NO/c1-13-11-8-4-6-9-5-2-3-7-10(9)12-11/h2-3,5,7H,4,6,8H2,1H3 |
| InChIKey | YCJFLDMFVWJOMB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methoxy-4,5-dihydro-3H-1-benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-4,5-dihydro-3H-1-benzazepine?
The IUPAC name of 2-methoxy-4,5-dihydro-3H-1-benzazepine (CID 18428530) is 2-methoxy-4,5-dihydro-3H-1-benzazepine.
What is the SMILES notation for 2-methoxy-4,5-dihydro-3H-1-benzazepine?
The canonical SMILES for 2-methoxy-4,5-dihydro-3H-1-benzazepine is COC1=Nc2ccccc2CCC1.
What is the InChIKey of 2-methoxy-4,5-dihydro-3H-1-benzazepine?
The InChIKey is YCJFLDMFVWJOMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO/c1-13-11-8-4-6-9-5-2-3-7-10(9)12-11/h2-3,5,7H,4,6,8H2,1H3.
What are the key properties of 2-methoxy-4,5-dihydro-3H-1-benzazepine?
2-methoxy-4,5-dihydro-3H-1-benzazepine has a molecular weight of 175.23 g/mol, XLogP of 2.70, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-4,5-dihydro-3H-1-benzazepine is sourced from PubChem (CID 18428530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).