About 6-amino-3,4-dihydro-2H-pyridin-5-one;hydrochloride
6-amino-3,4-dihydro-2H-pyridin-5-one;hydrochloride (PubChem CID 18428532) has the molecular formula C5H9ClN2O
and a molecular weight of 148.59 g/mol. Its IUPAC name is 6-amino-3,4-dihydro-2H-pyridin-5-one;hydrochloride.
Molecular Properties
| Compound Name | 6-amino-3,4-dihydro-2H-pyridin-5-one;hydrochloride |
| PubChem CID | 18428532 |
| Molecular Formula | C5H9ClN2O |
| Molecular Weight | 148.59 g/mol |
| Exact Mass | 148.04 |
| IUPAC Name | 6-amino-3,4-dihydro-2H-pyridin-5-one;hydrochloride |
| SMILES | Cl.NC1=NCCCC1=O |
| InChI | InChI=1S/C5H8N2O.ClH/c6-5-4(8)2-1-3-7-5;/h1-3H2,(H2,6,7);1H |
| InChIKey | JBAJCYVBUIBSFB-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.59 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-amino-3,4-dihydro-2H-pyridin-5-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-3,4-dihydro-2H-pyridin-5-one;hydrochloride?
The IUPAC name of 6-amino-3,4-dihydro-2H-pyridin-5-one;hydrochloride (CID 18428532) is 6-amino-3,4-dihydro-2H-pyridin-5-one;hydrochloride.
What is the SMILES notation for 6-amino-3,4-dihydro-2H-pyridin-5-one;hydrochloride?
The canonical SMILES for 6-amino-3,4-dihydro-2H-pyridin-5-one;hydrochloride is Cl.NC1=NCCCC1=O.
What is the InChIKey of 6-amino-3,4-dihydro-2H-pyridin-5-one;hydrochloride?
The InChIKey is JBAJCYVBUIBSFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O.ClH/c6-5-4(8)2-1-3-7-5;/h1-3H2,(H2,6,7);1H.
What are the key properties of 6-amino-3,4-dihydro-2H-pyridin-5-one;hydrochloride?
6-amino-3,4-dihydro-2H-pyridin-5-one;hydrochloride has a molecular weight of 148.59 g/mol, XLogP of 0.13, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-3,4-dihydro-2H-pyridin-5-one;hydrochloride is sourced from PubChem (CID 18428532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).