C8H16N2 — CID 18428536
3,3-dimethyl-2,4,5,6-tetrahydroazepin-7-amine (PubChem CID 18428536) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is 3,3-dimethyl-2,4,5,6-tetrahydroazepin-7-amine.
| Compound Name | 3,3-dimethyl-2,4,5,6-tetrahydroazepin-7-amine |
|---|---|
| PubChem CID | 18428536 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 3,3-dimethyl-2,4,5,6-tetrahydroazepin-7-amine |
| SMILES | CC1(C)CCCC(N)=NC1 |
| InChI | InChI=1S/C8H16N2/c1-8(2)5-3-4-7(9)10-6-8/h3-6H2,1-2H3,(H2,9,10) |
| InChIKey | WOIIKMVKEOGGOM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |