About 2,3,4,5-tetrahydropyridine-4,6-diamine;dihydrobromide
2,3,4,5-tetrahydropyridine-4,6-diamine;dihydrobromide (PubChem CID 18428539) has the molecular formula C5H13Br2N3
and a molecular weight of 274.99 g/mol. Its IUPAC name is 2,3,4,5-tetrahydropyridine-4,6-diamine;dihydrobromide.
Analyze 2,3,4,5-tetrahydropyridine-4,6-diamine;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4,5-tetrahydropyridine-4,6-diamine;dihydrobromide?
The IUPAC name of 2,3,4,5-tetrahydropyridine-4,6-diamine;dihydrobromide (CID 18428539) is 2,3,4,5-tetrahydropyridine-4,6-diamine;dihydrobromide.
What is the SMILES notation for 2,3,4,5-tetrahydropyridine-4,6-diamine;dihydrobromide?
The canonical SMILES for 2,3,4,5-tetrahydropyridine-4,6-diamine;dihydrobromide is Br.Br.NC1=NCCC(N)C1.
What is the InChIKey of 2,3,4,5-tetrahydropyridine-4,6-diamine;dihydrobromide?
The InChIKey is MHQRECKUEFPRSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N3.2BrH/c6-4-1-2-8-5(7)3-4;;/h4H,1-3,6H2,(H2,7,8);2*1H.
What are the key properties of 2,3,4,5-tetrahydropyridine-4,6-diamine;dihydrobromide?
2,3,4,5-tetrahydropyridine-4,6-diamine;dihydrobromide has a molecular weight of 274.99 g/mol, XLogP of 0.62, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4,5-tetrahydropyridine-4,6-diamine;dihydrobromide is sourced from PubChem (CID 18428539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).