About 3-amino-6-(5-amino-3,4-dihydro-2H-pyrrol-2-yl)hexane-1,2-diol
3-amino-6-(5-amino-3,4-dihydro-2H-pyrrol-2-yl)hexane-1,2-diol (PubChem CID 18428644) has the molecular formula C10H21N3O2
and a molecular weight of 215.30 g/mol. Its IUPAC name is 3-amino-6-(5-amino-3,4-dihydro-2H-pyrrol-2-yl)hexane-1,2-diol.
Molecular Properties
| Compound Name | 3-amino-6-(5-amino-3,4-dihydro-2H-pyrrol-2-yl)hexane-1,2-diol |
| PubChem CID | 18428644 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | 3-amino-6-(5-amino-3,4-dihydro-2H-pyrrol-2-yl)hexane-1,2-diol |
| SMILES | NC1=NC(CCCC(N)C(O)CO)CC1 |
| InChI | InChI=1S/C10H21N3O2/c11-8(9(15)6-14)3-1-2-7-4-5-10(12)13-7/h7-9,14-15H,1-6,11H2,(H2,12,13) |
| InChIKey | BDYZWMZIYNYSPK-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-6-(5-amino-3,4-dihydro-2H-pyrrol-2-yl)hexane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-6-(5-amino-3,4-dihydro-2H-pyrrol-2-yl)hexane-1,2-diol?
The IUPAC name of 3-amino-6-(5-amino-3,4-dihydro-2H-pyrrol-2-yl)hexane-1,2-diol (CID 18428644) is 3-amino-6-(5-amino-3,4-dihydro-2H-pyrrol-2-yl)hexane-1,2-diol.
What is the SMILES notation for 3-amino-6-(5-amino-3,4-dihydro-2H-pyrrol-2-yl)hexane-1,2-diol?
The canonical SMILES for 3-amino-6-(5-amino-3,4-dihydro-2H-pyrrol-2-yl)hexane-1,2-diol is NC1=NC(CCCC(N)C(O)CO)CC1.
What is the InChIKey of 3-amino-6-(5-amino-3,4-dihydro-2H-pyrrol-2-yl)hexane-1,2-diol?
The InChIKey is BDYZWMZIYNYSPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N3O2/c11-8(9(15)6-14)3-1-2-7-4-5-10(12)13-7/h7-9,14-15H,1-6,11H2,(H2,12,13).
What are the key properties of 3-amino-6-(5-amino-3,4-dihydro-2H-pyrrol-2-yl)hexane-1,2-diol?
3-amino-6-(5-amino-3,4-dihydro-2H-pyrrol-2-yl)hexane-1,2-diol has a molecular weight of 215.30 g/mol, XLogP of -0.64, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-6-(5-amino-3,4-dihydro-2H-pyrrol-2-yl)hexane-1,2-diol is sourced from PubChem (CID 18428644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).