C16H20N2O3S2 — CID 18428690
N-[3-(methylaminomethyl)-4-(4-methylsulfanylphenoxy)phenyl]methanesulfonamide (PubChem CID 18428690) has the molecular formula C16H20N2O3S2 and a molecular weight of 352.48 g/mol. Its IUPAC name is N-[3-(methylaminomethyl)-4-(4-methylsulfanylphenoxy)phenyl]methanesulfonamide.
| Compound Name | N-[3-(methylaminomethyl)-4-(4-methylsulfanylphenoxy)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 18428690 |
| Molecular Formula | C16H20N2O3S2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | N-[3-(methylaminomethyl)-4-(4-methylsulfanylphenoxy)phenyl]methanesulfonamide |
| SMILES | CNCc1cc(NS(C)(=O)=O)ccc1Oc1ccc(SC)cc1 |
| InChI | InChI=1S/C16H20N2O3S2/c1-17-11-12-10-13(18-23(3,19)20)4-9-16(12)21-14-5-7-15(22-2)8-6-14/h4-10,17-18H,11H2,1-3H3 |
| InChIKey | SNPSZRHSFIRMEF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |