C29H33I3N2O16 — CID 18429179
[2,4,6-triiodo-3,5-bis(2,3,4-triacetyloxybutanoylamino)phenyl]methyl acetate (PubChem CID 18429179) has the molecular formula C29H33I3N2O16 and a molecular weight of 1046.29 g/mol. Its IUPAC name is [2,4,6-triiodo-3,5-bis(2,3,4-triacetyloxybutanoylamino)phenyl]methyl acetate.
| Compound Name | [2,4,6-triiodo-3,5-bis(2,3,4-triacetyloxybutanoylamino)phenyl]methyl acetate |
|---|---|
| PubChem CID | 18429179 |
| Molecular Formula | C29H33I3N2O16 |
| Molecular Weight | 1046.29 g/mol |
| Exact Mass | 1045.90 |
| IUPAC Name | [2,4,6-triiodo-3,5-bis(2,3,4-triacetyloxybutanoylamino)phenyl]methyl acetate |
| SMILES | CC(=O)OCc1c(I)c(NC(=O)C(OC(C)=O)C(COC(C)=O)OC(C)=O)c(I)c(NC(=O)C(OC(C)=O)C(COC(C)=O)OC(C)=O)c1I |
| InChI | InChI=1S/C29H33I3N2O16/c1-11(35)44-8-18-21(30)24(33-28(42)26(49-16(6)40)19(47-14(4)38)9-45-12(2)36)23(32)25(22(18)31)34-29(43)27(50-17(7)41)20(48-15(5)39)10-46-13(3)37/h19-20,26-27H,8-10H2,1-7H3,(H,33,42)(H,34,43) |
| InChIKey | XJECBQXDLWOAAE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 242.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1046.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|