C20H23I3N2O9 — CID 18429369
[3-amino-5-[[1,3-diacetyloxy-2-(acetyloxymethyl)propan-2-yl]carbamoyl]-2,4,6-triiodophenyl]methyl acetate (PubChem CID 18429369) has the molecular formula C20H23I3N2O9 and a molecular weight of 816.12 g/mol. Its IUPAC name is [3-amino-5-[[1,3-diacetyloxy-2-(acetyloxymethyl)propan-2-yl]carbamoyl]-2,4,6-triiodophenyl]methyl acetate.
| Compound Name | [3-amino-5-[[1,3-diacetyloxy-2-(acetyloxymethyl)propan-2-yl]carbamoyl]-2,4,6-triiodophenyl]methyl acetate |
|---|---|
| PubChem CID | 18429369 |
| Molecular Formula | C20H23I3N2O9 |
| Molecular Weight | 816.12 g/mol |
| Exact Mass | 815.85 |
| IUPAC Name | [3-amino-5-[[1,3-diacetyloxy-2-(acetyloxymethyl)propan-2-yl]carbamoyl]-2,4,6-triiodophenyl]methyl acetate |
| SMILES | CC(=O)OCc1c(I)c(N)c(I)c(C(=O)NC(COC(C)=O)(COC(C)=O)COC(C)=O)c1I |
| InChI | InChI=1S/C20H23I3N2O9/c1-9(26)31-5-13-15(21)14(17(23)18(24)16(13)22)19(30)25-20(6-32-10(2)27,7-33-11(3)28)8-34-12(4)29/h5-8,24H2,1-4H3,(H,25,30) |
| InChIKey | IWGVTHCSSRPXKJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 160.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.12 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|