C27H32Cl2F3NO4 — CID 18429653
(E)-2-[4-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]butoxy]-N-[[4-(trifluoromethyl)phenyl]methoxy]ethanimine (PubChem CID 18429653) has the molecular formula C27H32Cl2F3NO4 and a molecular weight of 562.46 g/mol. Its IUPAC name is (E)-2-[4-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]butoxy]-N-[[4-(trifluoromethyl)phenyl]methoxy]ethanimine.
| Compound Name | (E)-2-[4-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]butoxy]-N-[[4-(trifluoromethyl)phenyl]methoxy]ethanimine |
|---|---|
| PubChem CID | 18429653 |
| Molecular Formula | C27H32Cl2F3NO4 |
| Molecular Weight | 562.46 g/mol |
| Exact Mass | 561.17 |
| IUPAC Name | (E)-2-[4-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]butoxy]-N-[[4-(trifluoromethyl)phenyl]methoxy]ethanimine |
| SMILES | CCc1cc(OCC=C(Cl)Cl)cc(CC)c1OCCCCOC/C=N/OCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H32Cl2F3NO4/c1-3-21-17-24(35-15-11-25(28)29)18-22(4-2)26(21)36-14-6-5-13-34-16-12-33-37-19-20-7-9-23(10-8-20)27(30,31)32/h7-12,17-18H,3-6,13-16,19H2,1-2H3/b33-12+ |
| InChIKey | NWQQYNHMCULOIZ-RVDKCFQWSA-N |
| XLogP | 7.91 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.46 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|