C16H16Cl4F3NO3 — CID 18430010
(E)-5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]-N-(2,2,2-trifluoroethoxy)pentan-1-imine (PubChem CID 18430010) has the molecular formula C16H16Cl4F3NO3 and a molecular weight of 469.11 g/mol. Its IUPAC name is (E)-5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]-N-(2,2,2-trifluoroethoxy)pentan-1-imine.
| Compound Name | (E)-5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]-N-(2,2,2-trifluoroethoxy)pentan-1-imine |
|---|---|
| PubChem CID | 18430010 |
| Molecular Formula | C16H16Cl4F3NO3 |
| Molecular Weight | 469.11 g/mol |
| Exact Mass | 466.98 |
| IUPAC Name | (E)-5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]-N-(2,2,2-trifluoroethoxy)pentan-1-imine |
| SMILES | FC(F)(F)CO/N=C/CCCCOc1c(Cl)cc(OCC=C(Cl)Cl)cc1Cl |
| InChI | InChI=1S/C16H16Cl4F3NO3/c17-12-8-11(25-7-4-14(19)20)9-13(18)15(12)26-6-3-1-2-5-24-27-10-16(21,22)23/h4-5,8-9H,1-3,6-7,10H2/b24-5+ |
| InChIKey | IXHGHMZUGUPKJW-ZXKDJJQISA-N |
| XLogP | 6.80 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.11 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|