C18H20Cl4F3NO4 — CID 18430246
(E)-2-[5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]-N-(2,2,2-trifluoroethoxy)ethanimine (PubChem CID 18430246) has the molecular formula C18H20Cl4F3NO4 and a molecular weight of 513.17 g/mol. Its IUPAC name is (E)-2-[5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]-N-(2,2,2-trifluoroethoxy)ethanimine.
| Compound Name | (E)-2-[5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]-N-(2,2,2-trifluoroethoxy)ethanimine |
|---|---|
| PubChem CID | 18430246 |
| Molecular Formula | C18H20Cl4F3NO4 |
| Molecular Weight | 513.17 g/mol |
| Exact Mass | 511.01 |
| IUPAC Name | (E)-2-[5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]-N-(2,2,2-trifluoroethoxy)ethanimine |
| SMILES | FC(F)(F)CO/N=C/COCCCCCOc1c(Cl)cc(OCC=C(Cl)Cl)cc1Cl |
| InChI | InChI=1S/C18H20Cl4F3NO4/c19-14-10-13(28-8-4-16(21)22)11-15(20)17(14)29-7-3-1-2-6-27-9-5-26-30-12-18(23,24)25/h4-5,10-11H,1-3,6-9,12H2/b26-5+ |
| InChIKey | CYJZFWNCKATTQJ-MBAGFTIUSA-N |
| XLogP | 6.82 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.17 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|