About dioxido(oxo)germane;bis(tetramethylazanium)
dioxido(oxo)germane;bis(tetramethylazanium) (PubChem CID 18430329) has the molecular formula C8H24GeN2O3
and a molecular weight of 268.90 g/mol. Its IUPAC name is dioxido(oxo)germane;bis(tetramethylazanium).
Molecular Properties
| Compound Name | dioxido(oxo)germane;bis(tetramethylazanium) |
| PubChem CID | 18430329 |
| Molecular Formula | C8H24GeN2O3 |
| Molecular Weight | 268.90 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | dioxido(oxo)germane;bis(tetramethylazanium) |
| SMILES | C[N+](C)(C)C.C[N+](C)(C)C.O=[Ge]([O-])[O-] |
| InChI | InChI=1S/2C4H12N.GeO3/c2*1-5(2,3)4;2-1(3)4/h2*1-4H3;/q2*+1;-2 |
| InChIKey | DVFFLJGUKFQHJL-UHFFFAOYSA-N |
| XLogP | -2.23 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.90 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze dioxido(oxo)germane;bis(tetramethylazanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxido(oxo)germane;bis(tetramethylazanium)?
The IUPAC name of dioxido(oxo)germane;bis(tetramethylazanium) (CID 18430329) is dioxido(oxo)germane;bis(tetramethylazanium).
What is the SMILES notation for dioxido(oxo)germane;bis(tetramethylazanium)?
The canonical SMILES for dioxido(oxo)germane;bis(tetramethylazanium) is C[N+](C)(C)C.C[N+](C)(C)C.O=[Ge]([O-])[O-].
What is the InChIKey of dioxido(oxo)germane;bis(tetramethylazanium)?
The InChIKey is DVFFLJGUKFQHJL-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H12N.GeO3/c2*1-5(2,3)4;2-1(3)4/h2*1-4H3;/q2*+1;-2.
What are the key properties of dioxido(oxo)germane;bis(tetramethylazanium)?
dioxido(oxo)germane;bis(tetramethylazanium) has a molecular weight of 268.90 g/mol, XLogP of -2.23, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dioxido(oxo)germane;bis(tetramethylazanium) is sourced from PubChem (CID 18430329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).