About bis(1,2,3-trimethylcyclopenta-1,3-diene);zirconium(2+)
bis(1,2,3-trimethylcyclopenta-1,3-diene);zirconium(2+) (PubChem CID 18431337) has the molecular formula C16H22Zr
and a molecular weight of 305.58 g/mol. Its IUPAC name is bis(1,2,3-trimethylcyclopenta-1,3-diene);zirconium(2+).
Molecular Properties
| Compound Name | bis(1,2,3-trimethylcyclopenta-1,3-diene);zirconium(2+) |
| PubChem CID | 18431337 |
| Molecular Formula | C16H22Zr |
| Molecular Weight | 305.58 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | bis(1,2,3-trimethylcyclopenta-1,3-diene);zirconium(2+) |
| SMILES | CC1=[C-]CC(C)=C1C.CC1=[C-]CC(C)=C1C.[Zr+2] |
| InChI | InChI=1S/2C8H11.Zr/c2*1-6-4-5-7(2)8(6)3;/h2*4H2,1-3H3;/q2*-1;+2 |
| InChIKey | BTWRXLMBFSFJKB-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.58 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze bis(1,2,3-trimethylcyclopenta-1,3-diene);zirconium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1,2,3-trimethylcyclopenta-1,3-diene);zirconium(2+)?
The IUPAC name of bis(1,2,3-trimethylcyclopenta-1,3-diene);zirconium(2+) (CID 18431337) is bis(1,2,3-trimethylcyclopenta-1,3-diene);zirconium(2+).
What is the SMILES notation for bis(1,2,3-trimethylcyclopenta-1,3-diene);zirconium(2+)?
The canonical SMILES for bis(1,2,3-trimethylcyclopenta-1,3-diene);zirconium(2+) is CC1=[C-]CC(C)=C1C.CC1=[C-]CC(C)=C1C.[Zr+2].
What is the InChIKey of bis(1,2,3-trimethylcyclopenta-1,3-diene);zirconium(2+)?
The InChIKey is BTWRXLMBFSFJKB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H11.Zr/c2*1-6-4-5-7(2)8(6)3;/h2*4H2,1-3H3;/q2*-1;+2.
What are the key properties of bis(1,2,3-trimethylcyclopenta-1,3-diene);zirconium(2+)?
bis(1,2,3-trimethylcyclopenta-1,3-diene);zirconium(2+) has a molecular weight of 305.58 g/mol, XLogP of 4.95, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1,2,3-trimethylcyclopenta-1,3-diene);zirconium(2+) is sourced from PubChem (CID 18431337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).