About 1-(4-bromophenyl)-2-(2,6-diamino-1,3-benzothiazol-3-ium-3-yl)ethanone
1-(4-bromophenyl)-2-(2,6-diamino-1,3-benzothiazol-3-ium-3-yl)ethanone (PubChem CID 18432199) has the molecular formula C15H13BrN3OS+
and a molecular weight of 363.26 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-(2,6-diamino-1,3-benzothiazol-3-ium-3-yl)ethanone.
Molecular Properties
| Compound Name | 1-(4-bromophenyl)-2-(2,6-diamino-1,3-benzothiazol-3-ium-3-yl)ethanone |
| PubChem CID | 18432199 |
| Molecular Formula | C15H13BrN3OS+ |
| Molecular Weight | 363.26 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | 1-(4-bromophenyl)-2-(2,6-diamino-1,3-benzothiazol-3-ium-3-yl)ethanone |
| SMILES | Nc1ccc2c(c1)sc(N)[n+]2CC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H12BrN3OS/c16-10-3-1-9(2-4-10)13(20)8-19-12-6-5-11(17)7-14(12)21-15(19)18/h1-7,18H,8,17H2/p+1 |
| InChIKey | DHUHDONVKKDJKN-UHFFFAOYSA-O |
| XLogP | 3.00 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-bromophenyl)-2-(2,6-diamino-1,3-benzothiazol-3-ium-3-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromophenyl)-2-(2,6-diamino-1,3-benzothiazol-3-ium-3-yl)ethanone?
The IUPAC name of 1-(4-bromophenyl)-2-(2,6-diamino-1,3-benzothiazol-3-ium-3-yl)ethanone (CID 18432199) is 1-(4-bromophenyl)-2-(2,6-diamino-1,3-benzothiazol-3-ium-3-yl)ethanone.
What is the SMILES notation for 1-(4-bromophenyl)-2-(2,6-diamino-1,3-benzothiazol-3-ium-3-yl)ethanone?
The canonical SMILES for 1-(4-bromophenyl)-2-(2,6-diamino-1,3-benzothiazol-3-ium-3-yl)ethanone is Nc1ccc2c(c1)sc(N)[n+]2CC(=O)c1ccc(Br)cc1.
What is the InChIKey of 1-(4-bromophenyl)-2-(2,6-diamino-1,3-benzothiazol-3-ium-3-yl)ethanone?
The InChIKey is DHUHDONVKKDJKN-UHFFFAOYSA-O. The full InChI is InChI=1S/C15H12BrN3OS/c16-10-3-1-9(2-4-10)13(20)8-19-12-6-5-11(17)7-14(12)21-15(19)18/h1-7,18H,8,17H2/p+1.
What are the key properties of 1-(4-bromophenyl)-2-(2,6-diamino-1,3-benzothiazol-3-ium-3-yl)ethanone?
1-(4-bromophenyl)-2-(2,6-diamino-1,3-benzothiazol-3-ium-3-yl)ethanone has a molecular weight of 363.26 g/mol, XLogP of 3.00, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromophenyl)-2-(2,6-diamino-1,3-benzothiazol-3-ium-3-yl)ethanone is sourced from PubChem (CID 18432199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).