About methyl 2-(1,3-thiazol-3-ium-3-yl)acetate
methyl 2-(1,3-thiazol-3-ium-3-yl)acetate (PubChem CID 18432213) has the molecular formula C6H8NO2S+
and a molecular weight of 158.20 g/mol. Its IUPAC name is methyl 2-(1,3-thiazol-3-ium-3-yl)acetate.
Molecular Properties
| Compound Name | methyl 2-(1,3-thiazol-3-ium-3-yl)acetate |
| PubChem CID | 18432213 |
| Molecular Formula | C6H8NO2S+ |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.03 |
| IUPAC Name | methyl 2-(1,3-thiazol-3-ium-3-yl)acetate |
| SMILES | COC(=O)C[n+]1ccsc1 |
| InChI | InChI=1S/C6H8NO2S/c1-9-6(8)4-7-2-3-10-5-7/h2-3,5H,4H2,1H3/q+1 |
| InChIKey | VSVVGFZDIDJTLB-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(1,3-thiazol-3-ium-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(1,3-thiazol-3-ium-3-yl)acetate?
The IUPAC name of methyl 2-(1,3-thiazol-3-ium-3-yl)acetate (CID 18432213) is methyl 2-(1,3-thiazol-3-ium-3-yl)acetate.
What is the SMILES notation for methyl 2-(1,3-thiazol-3-ium-3-yl)acetate?
The canonical SMILES for methyl 2-(1,3-thiazol-3-ium-3-yl)acetate is COC(=O)C[n+]1ccsc1.
What is the InChIKey of methyl 2-(1,3-thiazol-3-ium-3-yl)acetate?
The InChIKey is VSVVGFZDIDJTLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8NO2S/c1-9-6(8)4-7-2-3-10-5-7/h2-3,5H,4H2,1H3/q+1.
What are the key properties of methyl 2-(1,3-thiazol-3-ium-3-yl)acetate?
methyl 2-(1,3-thiazol-3-ium-3-yl)acetate has a molecular weight of 158.20 g/mol, XLogP of 0.21, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(1,3-thiazol-3-ium-3-yl)acetate is sourced from PubChem (CID 18432213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).