methyl 2-(1,3-thiazol-3-ium-3-yl)acetate

C6H8NO2S+ — CID 18432213

IUPACmethyl 2-(1,3-thiazol-3-ium-3-yl)acetate
SMILESCOC(=O)C[n+]1ccsc1
InChIInChI=1S/C6H8NO2S/c1-9-6(8)4-7-2-3-10-5-7/h2-3,5H,4H2,1H3/q+1
InChIKeyVSVVGFZDIDJTLB-UHFFFAOYSA-N
MW158.20 g/mol
LogP0.21
Rot. Bonds2

About methyl 2-(1,3-thiazol-3-ium-3-yl)acetate

methyl 2-(1,3-thiazol-3-ium-3-yl)acetate (PubChem CID 18432213) has the molecular formula C6H8NO2S+ and a molecular weight of 158.20 g/mol. Its IUPAC name is methyl 2-(1,3-thiazol-3-ium-3-yl)acetate.

Molecular Properties

Compound Namemethyl 2-(1,3-thiazol-3-ium-3-yl)acetate
PubChem CID18432213
Molecular FormulaC6H8NO2S+
Molecular Weight158.20 g/mol
Exact Mass158.03
IUPAC Namemethyl 2-(1,3-thiazol-3-ium-3-yl)acetate
SMILESCOC(=O)C[n+]1ccsc1
InChIInChI=1S/C6H8NO2S/c1-9-6(8)4-7-2-3-10-5-7/h2-3,5H,4H2,1H3/q+1
InChIKeyVSVVGFZDIDJTLB-UHFFFAOYSA-N
XLogP0.21
TPSA30.18 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500158.20
LogP ≤ 50.21
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}

Analyze methyl 2-(1,3-thiazol-3-ium-3-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(1,3-thiazol-3-ium-3-yl)acetate?
The IUPAC name of methyl 2-(1,3-thiazol-3-ium-3-yl)acetate (CID 18432213) is methyl 2-(1,3-thiazol-3-ium-3-yl)acetate.
What is the SMILES notation for methyl 2-(1,3-thiazol-3-ium-3-yl)acetate?
The canonical SMILES for methyl 2-(1,3-thiazol-3-ium-3-yl)acetate is COC(=O)C[n+]1ccsc1.
What is the InChIKey of methyl 2-(1,3-thiazol-3-ium-3-yl)acetate?
The InChIKey is VSVVGFZDIDJTLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8NO2S/c1-9-6(8)4-7-2-3-10-5-7/h2-3,5H,4H2,1H3/q+1.
What are the key properties of methyl 2-(1,3-thiazol-3-ium-3-yl)acetate?
methyl 2-(1,3-thiazol-3-ium-3-yl)acetate has a molecular weight of 158.20 g/mol, XLogP of 0.21, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(1,3-thiazol-3-ium-3-yl)acetate is sourced from PubChem (CID 18432213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).