C11H10F2NOS+ — CID 18432214
1-(2,4-difluorophenyl)-2-(4,5-dihydro-1,3-thiazol-3-ium-3-yl)ethanone (PubChem CID 18432214) has the molecular formula C11H10F2NOS+ and a molecular weight of 242.27 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-2-(4,5-dihydro-1,3-thiazol-3-ium-3-yl)ethanone.
| Compound Name | 1-(2,4-difluorophenyl)-2-(4,5-dihydro-1,3-thiazol-3-ium-3-yl)ethanone |
|---|---|
| PubChem CID | 18432214 |
| Molecular Formula | C11H10F2NOS+ |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 1-(2,4-difluorophenyl)-2-(4,5-dihydro-1,3-thiazol-3-ium-3-yl)ethanone |
| SMILES | O=C(C[N+]1=CSCC1)c1ccc(F)cc1F |
| InChI | InChI=1S/C11H10F2NOS/c12-8-1-2-9(10(13)5-8)11(15)6-14-3-4-16-7-14/h1-2,5,7H,3-4,6H2/q+1 |
| InChIKey | JDIAGYMFISIHDG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 20.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|