About 5-methyl-3-prop-2-ynyl-4,5-dihydro-1,3-thiazol-3-ium
5-methyl-3-prop-2-ynyl-4,5-dihydro-1,3-thiazol-3-ium (PubChem CID 18432223) has the molecular formula C7H10NS+
and a molecular weight of 140.23 g/mol. Its IUPAC name is 5-methyl-3-prop-2-ynyl-4,5-dihydro-1,3-thiazol-3-ium.
Molecular Properties
| Compound Name | 5-methyl-3-prop-2-ynyl-4,5-dihydro-1,3-thiazol-3-ium |
| PubChem CID | 18432223 |
| Molecular Formula | C7H10NS+ |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.05 |
| IUPAC Name | 5-methyl-3-prop-2-ynyl-4,5-dihydro-1,3-thiazol-3-ium |
| SMILES | C#CC[N+]1=CSC(C)C1 |
| InChI | InChI=1S/C7H10NS/c1-3-4-8-5-7(2)9-6-8/h1,6-7H,4-5H2,2H3/q+1 |
| InChIKey | UAZFJDTWESPHAW-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-3-prop-2-ynyl-4,5-dihydro-1,3-thiazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3-prop-2-ynyl-4,5-dihydro-1,3-thiazol-3-ium?
The IUPAC name of 5-methyl-3-prop-2-ynyl-4,5-dihydro-1,3-thiazol-3-ium (CID 18432223) is 5-methyl-3-prop-2-ynyl-4,5-dihydro-1,3-thiazol-3-ium.
What is the SMILES notation for 5-methyl-3-prop-2-ynyl-4,5-dihydro-1,3-thiazol-3-ium?
The canonical SMILES for 5-methyl-3-prop-2-ynyl-4,5-dihydro-1,3-thiazol-3-ium is C#CC[N+]1=CSC(C)C1.
What is the InChIKey of 5-methyl-3-prop-2-ynyl-4,5-dihydro-1,3-thiazol-3-ium?
The InChIKey is UAZFJDTWESPHAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10NS/c1-3-4-8-5-7(2)9-6-8/h1,6-7H,4-5H2,2H3/q+1.
What are the key properties of 5-methyl-3-prop-2-ynyl-4,5-dihydro-1,3-thiazol-3-ium?
5-methyl-3-prop-2-ynyl-4,5-dihydro-1,3-thiazol-3-ium has a molecular weight of 140.23 g/mol, XLogP of 0.80, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-prop-2-ynyl-4,5-dihydro-1,3-thiazol-3-ium is sourced from PubChem (CID 18432223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).