About 6-(5-iodo-3-pyridinyl)-3,6-diazabicyclo[3.2.1]octane
6-(5-iodo-3-pyridinyl)-3,6-diazabicyclo[3.2.1]octane (PubChem CID 18432735) has the molecular formula C11H14IN3
and a molecular weight of 315.16 g/mol. Its IUPAC name is 6-(5-iodo-3-pyridinyl)-3,6-diazabicyclo[3.2.1]octane.
Molecular Properties
| Compound Name | 6-(5-iodo-3-pyridinyl)-3,6-diazabicyclo[3.2.1]octane |
| PubChem CID | 18432735 |
| Molecular Formula | C11H14IN3 |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | 6-(5-iodo-3-pyridinyl)-3,6-diazabicyclo[3.2.1]octane |
| SMILES | Ic1cncc(N2CC3CNCC2C3)c1 |
| InChI | InChI=1S/C11H14IN3/c12-9-2-11(6-14-4-9)15-7-8-1-10(15)5-13-3-8/h2,4,6,8,10,13H,1,3,5,7H2 |
| InChIKey | JLHXWFFATLHELC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-(5-iodo-3-pyridinyl)-3,6-diazabicyclo[3.2.1]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(5-iodo-3-pyridinyl)-3,6-diazabicyclo[3.2.1]octane?
The IUPAC name of 6-(5-iodo-3-pyridinyl)-3,6-diazabicyclo[3.2.1]octane (CID 18432735) is 6-(5-iodo-3-pyridinyl)-3,6-diazabicyclo[3.2.1]octane.
What is the SMILES notation for 6-(5-iodo-3-pyridinyl)-3,6-diazabicyclo[3.2.1]octane?
The canonical SMILES for 6-(5-iodo-3-pyridinyl)-3,6-diazabicyclo[3.2.1]octane is Ic1cncc(N2CC3CNCC2C3)c1.
What is the InChIKey of 6-(5-iodo-3-pyridinyl)-3,6-diazabicyclo[3.2.1]octane?
The InChIKey is JLHXWFFATLHELC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14IN3/c12-9-2-11(6-14-4-9)15-7-8-1-10(15)5-13-3-8/h2,4,6,8,10,13H,1,3,5,7H2.
What are the key properties of 6-(5-iodo-3-pyridinyl)-3,6-diazabicyclo[3.2.1]octane?
6-(5-iodo-3-pyridinyl)-3,6-diazabicyclo[3.2.1]octane has a molecular weight of 315.16 g/mol, XLogP of 1.48, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(5-iodo-3-pyridinyl)-3,6-diazabicyclo[3.2.1]octane is sourced from PubChem (CID 18432735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).