About (3-methyl-1,2-thiazol-5-yl)urea
(3-methyl-1,2-thiazol-5-yl)urea (PubChem CID 18432878) has the molecular formula C5H7N3OS
and a molecular weight of 157.20 g/mol. Its IUPAC name is (3-methyl-1,2-thiazol-5-yl)urea.
Molecular Properties
| Compound Name | (3-methyl-1,2-thiazol-5-yl)urea |
| PubChem CID | 18432878 |
| Molecular Formula | C5H7N3OS |
| Molecular Weight | 157.20 g/mol |
| Exact Mass | 157.03 |
| IUPAC Name | (3-methyl-1,2-thiazol-5-yl)urea |
| SMILES | Cc1cc(NC(N)=O)sn1 |
| InChI | InChI=1S/C5H7N3OS/c1-3-2-4(10-8-3)7-5(6)9/h2H,1H3,(H3,6,7,9) |
| InChIKey | ZRCBYHAFBRLQMH-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.20 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-methyl-1,2-thiazol-5-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-1,2-thiazol-5-yl)urea?
The IUPAC name of (3-methyl-1,2-thiazol-5-yl)urea (CID 18432878) is (3-methyl-1,2-thiazol-5-yl)urea.
What is the SMILES notation for (3-methyl-1,2-thiazol-5-yl)urea?
The canonical SMILES for (3-methyl-1,2-thiazol-5-yl)urea is Cc1cc(NC(N)=O)sn1.
What is the InChIKey of (3-methyl-1,2-thiazol-5-yl)urea?
The InChIKey is ZRCBYHAFBRLQMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3OS/c1-3-2-4(10-8-3)7-5(6)9/h2H,1H3,(H3,6,7,9).
What are the key properties of (3-methyl-1,2-thiazol-5-yl)urea?
(3-methyl-1,2-thiazol-5-yl)urea has a molecular weight of 157.20 g/mol, XLogP of 0.94, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-1,2-thiazol-5-yl)urea is sourced from PubChem (CID 18432878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).