C19H28ClN3O2 — CID 18433344
3-(3-chloropropoxy)pyridine;N-propan-2-yl-3-pyridin-3-yloxypropan-1-amine (PubChem CID 18433344) has the molecular formula C19H28ClN3O2 and a molecular weight of 365.91 g/mol. Its IUPAC name is 3-(3-chloropropoxy)pyridine;N-propan-2-yl-3-pyridin-3-yloxypropan-1-amine.
| Compound Name | 3-(3-chloropropoxy)pyridine;N-propan-2-yl-3-pyridin-3-yloxypropan-1-amine |
|---|---|
| PubChem CID | 18433344 |
| Molecular Formula | C19H28ClN3O2 |
| Molecular Weight | 365.91 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 3-(3-chloropropoxy)pyridine;N-propan-2-yl-3-pyridin-3-yloxypropan-1-amine |
| SMILES | CC(C)NCCCOc1cccnc1.ClCCCOc1cccnc1 |
| InChI | InChI=1S/C11H18N2O.C8H10ClNO/c1-10(2)13-7-4-8-14-11-5-3-6-12-9-11;9-4-2-6-11-8-3-1-5-10-7-8/h3,5-6,9-10,13H,4,7-8H2,1-2H3;1,3,5,7H,2,4,6H2 |
| InChIKey | GNJHHIFIASUJOZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.91 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|