About ethyl 4-cyclopentylpentanoate
ethyl 4-cyclopentylpentanoate (PubChem CID 18433851) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is ethyl 4-cyclopentylpentanoate.
Molecular Properties
| Compound Name | ethyl 4-cyclopentylpentanoate |
| PubChem CID | 18433851 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | ethyl 4-cyclopentylpentanoate |
| SMILES | CCOC(=O)CCC(C)C1CCCC1 |
| InChI | InChI=1S/C12H22O2/c1-3-14-12(13)9-8-10(2)11-6-4-5-7-11/h10-11H,3-9H2,1-2H3 |
| InChIKey | CLXAUJXWXFEYTQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl 4-cyclopentylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-cyclopentylpentanoate?
The IUPAC name of ethyl 4-cyclopentylpentanoate (CID 18433851) is ethyl 4-cyclopentylpentanoate.
What is the SMILES notation for ethyl 4-cyclopentylpentanoate?
The canonical SMILES for ethyl 4-cyclopentylpentanoate is CCOC(=O)CCC(C)C1CCCC1.
What is the InChIKey of ethyl 4-cyclopentylpentanoate?
The InChIKey is CLXAUJXWXFEYTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2/c1-3-14-12(13)9-8-10(2)11-6-4-5-7-11/h10-11H,3-9H2,1-2H3.
What are the key properties of ethyl 4-cyclopentylpentanoate?
ethyl 4-cyclopentylpentanoate has a molecular weight of 198.31 g/mol, XLogP of 3.16, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-cyclopentylpentanoate is sourced from PubChem (CID 18433851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).