About methyl 2-[(2-ethoxy-2-oxoethyl)sulfanylmethyl]-3,3,3-trifluoropropanoate
methyl 2-[(2-ethoxy-2-oxoethyl)sulfanylmethyl]-3,3,3-trifluoropropanoate (PubChem CID 18434818) has the molecular formula C9H13F3O4S
and a molecular weight of 274.26 g/mol. Its IUPAC name is methyl 2-[(2-ethoxy-2-oxoethyl)sulfanylmethyl]-3,3,3-trifluoropropanoate.
Molecular Properties
| Compound Name | methyl 2-[(2-ethoxy-2-oxoethyl)sulfanylmethyl]-3,3,3-trifluoropropanoate |
| PubChem CID | 18434818 |
| Molecular Formula | C9H13F3O4S |
| Molecular Weight | 274.26 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | methyl 2-[(2-ethoxy-2-oxoethyl)sulfanylmethyl]-3,3,3-trifluoropropanoate |
| SMILES | CCOC(=O)CSCC(C(=O)OC)C(F)(F)F |
| InChI | InChI=1S/C9H13F3O4S/c1-3-16-7(13)5-17-4-6(8(14)15-2)9(10,11)12/h6H,3-5H2,1-2H3 |
| InChIKey | DIOCBOFEFZFFIR-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[(2-ethoxy-2-oxoethyl)sulfanylmethyl]-3,3,3-trifluoropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(2-ethoxy-2-oxoethyl)sulfanylmethyl]-3,3,3-trifluoropropanoate?
The IUPAC name of methyl 2-[(2-ethoxy-2-oxoethyl)sulfanylmethyl]-3,3,3-trifluoropropanoate (CID 18434818) is methyl 2-[(2-ethoxy-2-oxoethyl)sulfanylmethyl]-3,3,3-trifluoropropanoate.
What is the SMILES notation for methyl 2-[(2-ethoxy-2-oxoethyl)sulfanylmethyl]-3,3,3-trifluoropropanoate?
The canonical SMILES for methyl 2-[(2-ethoxy-2-oxoethyl)sulfanylmethyl]-3,3,3-trifluoropropanoate is CCOC(=O)CSCC(C(=O)OC)C(F)(F)F.
What is the InChIKey of methyl 2-[(2-ethoxy-2-oxoethyl)sulfanylmethyl]-3,3,3-trifluoropropanoate?
The InChIKey is DIOCBOFEFZFFIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F3O4S/c1-3-16-7(13)5-17-4-6(8(14)15-2)9(10,11)12/h6H,3-5H2,1-2H3.
What are the key properties of methyl 2-[(2-ethoxy-2-oxoethyl)sulfanylmethyl]-3,3,3-trifluoropropanoate?
methyl 2-[(2-ethoxy-2-oxoethyl)sulfanylmethyl]-3,3,3-trifluoropropanoate has a molecular weight of 274.26 g/mol, XLogP of 1.63, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2-ethoxy-2-oxoethyl)sulfanylmethyl]-3,3,3-trifluoropropanoate is sourced from PubChem (CID 18434818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).