C23H29F2NO — CID 18435011
N-[3-[(2,6-difluorophenyl)methoxy]-2-(2,6-dimethylphenyl)propyl]-N,2-dimethylprop-2-en-1-amine (PubChem CID 18435011) has the molecular formula C23H29F2NO and a molecular weight of 373.49 g/mol. Its IUPAC name is N-[3-[(2,6-difluorophenyl)methoxy]-2-(2,6-dimethylphenyl)propyl]-N,2-dimethylprop-2-en-1-amine.
| Compound Name | N-[3-[(2,6-difluorophenyl)methoxy]-2-(2,6-dimethylphenyl)propyl]-N,2-dimethylprop-2-en-1-amine |
|---|---|
| PubChem CID | 18435011 |
| Molecular Formula | C23H29F2NO |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | N-[3-[(2,6-difluorophenyl)methoxy]-2-(2,6-dimethylphenyl)propyl]-N,2-dimethylprop-2-en-1-amine |
| SMILES | C=C(C)CN(C)CC(COCc1c(F)cccc1F)c1c(C)cccc1C |
| InChI | InChI=1S/C23H29F2NO/c1-16(2)12-26(5)13-19(23-17(3)8-6-9-18(23)4)14-27-15-20-21(24)10-7-11-22(20)25/h6-11,19H,1,12-15H2,2-5H3 |
| InChIKey | XZPLEKPZZSDTLD-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|