AlO8PS-2 — CID 18435162
aluminum;phosphate;sulfate (PubChem CID 18435162) has the molecular formula AlO8PS-2 and a molecular weight of 218.01 g/mol. Its IUPAC name is aluminum;phosphate;sulfate.
| Compound Name | aluminum;phosphate;sulfate |
|---|---|
| PubChem CID | 18435162 |
| Molecular Formula | AlO8PS-2 |
| Molecular Weight | 218.01 g/mol |
| Exact Mass | 217.89 |
| IUPAC Name | aluminum;phosphate;sulfate |
| SMILES | O=P([O-])([O-])[O-].O=S(=O)([O-])[O-].[Al+3] |
| InChI | InChI=1S/Al.H3O4P.H2O4S/c;2*1-5(2,3)4/h;(H3,1,2,3,4);(H2,1,2,3,4)/q+3;;/p-5 |
| InChIKey | WTDPSUUWWKMZLE-UHFFFAOYSA-I |
| XLogP | -4.54 |
| TPSA | 166.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.01 |
| LogP ≤ 5 | -4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|