About 6-amino-2,3-difluorobenzenethiol
6-amino-2,3-difluorobenzenethiol (PubChem CID 18435220) has the molecular formula C6H5F2NS
and a molecular weight of 161.18 g/mol. Its IUPAC name is 6-amino-2,3-difluorobenzenethiol.
Molecular Properties
| Compound Name | 6-amino-2,3-difluorobenzenethiol |
| PubChem CID | 18435220 |
| Molecular Formula | C6H5F2NS |
| Molecular Weight | 161.18 g/mol |
| Exact Mass | 161.01 |
| IUPAC Name | 6-amino-2,3-difluorobenzenethiol |
| SMILES | Nc1ccc(F)c(F)c1S |
| InChI | InChI=1S/C6H5F2NS/c7-3-1-2-4(9)6(10)5(3)8/h1-2,10H,9H2 |
| InChIKey | BKCUATSGRVPZAH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.18 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-2,3-difluorobenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-2,3-difluorobenzenethiol?
The IUPAC name of 6-amino-2,3-difluorobenzenethiol (CID 18435220) is 6-amino-2,3-difluorobenzenethiol.
What is the SMILES notation for 6-amino-2,3-difluorobenzenethiol?
The canonical SMILES for 6-amino-2,3-difluorobenzenethiol is Nc1ccc(F)c(F)c1S.
What is the InChIKey of 6-amino-2,3-difluorobenzenethiol?
The InChIKey is BKCUATSGRVPZAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5F2NS/c7-3-1-2-4(9)6(10)5(3)8/h1-2,10H,9H2.
What are the key properties of 6-amino-2,3-difluorobenzenethiol?
6-amino-2,3-difluorobenzenethiol has a molecular weight of 161.18 g/mol, XLogP of 1.84, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-2,3-difluorobenzenethiol is sourced from PubChem (CID 18435220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).