About N,N,2-triethyloctanamide
N,N,2-triethyloctanamide (PubChem CID 18435349) has the molecular formula C14H29NO
and a molecular weight of 227.39 g/mol. Its IUPAC name is N,N,2-triethyloctanamide.
Molecular Properties
| Compound Name | N,N,2-triethyloctanamide |
| PubChem CID | 18435349 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | N,N,2-triethyloctanamide |
| SMILES | CCCCCCC(CC)C(=O)N(CC)CC |
| InChI | InChI=1S/C14H29NO/c1-5-9-10-11-12-13(6-2)14(16)15(7-3)8-4/h13H,5-12H2,1-4H3 |
| InChIKey | BRRFKKPUGJEBRF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N,2-triethyloctanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N,2-triethyloctanamide?
The IUPAC name of N,N,2-triethyloctanamide (CID 18435349) is N,N,2-triethyloctanamide.
What is the SMILES notation for N,N,2-triethyloctanamide?
The canonical SMILES for N,N,2-triethyloctanamide is CCCCCCC(CC)C(=O)N(CC)CC.
What is the InChIKey of N,N,2-triethyloctanamide?
The InChIKey is BRRFKKPUGJEBRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO/c1-5-9-10-11-12-13(6-2)14(16)15(7-3)8-4/h13H,5-12H2,1-4H3.
What are the key properties of N,N,2-triethyloctanamide?
N,N,2-triethyloctanamide has a molecular weight of 227.39 g/mol, XLogP of 3.85, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N,2-triethyloctanamide is sourced from PubChem (CID 18435349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).