About 4-[2-[(E)-2-(1,3-benzoxazol-2-yl)ethenyl]-6-chlorophenoxy]-N,N-dipropylbutan-1-amine
4-[2-[(E)-2-(1,3-benzoxazol-2-yl)ethenyl]-6-chlorophenoxy]-N,N-dipropylbutan-1-amine (PubChem CID 18435645) has the molecular formula C25H31ClN2O2
and a molecular weight of 426.99 g/mol. Its IUPAC name is 4-[2-[(E)-2-(1,3-benzoxazol-2-yl)ethenyl]-6-chlorophenoxy]-N,N-dipropylbutan-1-amine.
Molecular Properties
| Compound Name | 4-[2-[(E)-2-(1,3-benzoxazol-2-yl)ethenyl]-6-chlorophenoxy]-N,N-dipropylbutan-1-amine |
| PubChem CID | 18435645 |
| Molecular Formula | C25H31ClN2O2 |
| Molecular Weight | 426.99 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 4-[2-[(E)-2-(1,3-benzoxazol-2-yl)ethenyl]-6-chlorophenoxy]-N,N-dipropylbutan-1-amine |
| SMILES | CCCN(CCC)CCCCOc1c(Cl)cccc1/C=C/c1nc2ccccc2o1 |
| InChI | InChI=1S/C25H31ClN2O2/c1-3-16-28(17-4-2)18-7-8-19-29-25-20(10-9-11-21(25)26)14-15-24-27-22-12-5-6-13-23(22)30-24/h5-6,9-15H,3-4,7-8,16-19H2,1-2H3/b15-14+ |
| InChIKey | VCZBVLUARFORGJ-CCEZHUSRSA-N |
| XLogP | 6.93 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.99 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-[(E)-2-(1,3-benzoxazol-2-yl)ethenyl]-6-chlorophenoxy]-N,N-dipropylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[(E)-2-(1,3-benzoxazol-2-yl)ethenyl]-6-chlorophenoxy]-N,N-dipropylbutan-1-amine?
The IUPAC name of 4-[2-[(E)-2-(1,3-benzoxazol-2-yl)ethenyl]-6-chlorophenoxy]-N,N-dipropylbutan-1-amine (CID 18435645) is 4-[2-[(E)-2-(1,3-benzoxazol-2-yl)ethenyl]-6-chlorophenoxy]-N,N-dipropylbutan-1-amine.
What is the SMILES notation for 4-[2-[(E)-2-(1,3-benzoxazol-2-yl)ethenyl]-6-chlorophenoxy]-N,N-dipropylbutan-1-amine?
The canonical SMILES for 4-[2-[(E)-2-(1,3-benzoxazol-2-yl)ethenyl]-6-chlorophenoxy]-N,N-dipropylbutan-1-amine is CCCN(CCC)CCCCOc1c(Cl)cccc1/C=C/c1nc2ccccc2o1.
What is the InChIKey of 4-[2-[(E)-2-(1,3-benzoxazol-2-yl)ethenyl]-6-chlorophenoxy]-N,N-dipropylbutan-1-amine?
The InChIKey is VCZBVLUARFORGJ-CCEZHUSRSA-N. The full InChI is InChI=1S/C25H31ClN2O2/c1-3-16-28(17-4-2)18-7-8-19-29-25-20(10-9-11-21(25)26)14-15-24-27-22-12-5-6-13-23(22)30-24/h5-6,9-15H,3-4,7-8,16-19H2,1-2H3/b15-14+.
What are the key properties of 4-[2-[(E)-2-(1,3-benzoxazol-2-yl)ethenyl]-6-chlorophenoxy]-N,N-dipropylbutan-1-amine?
4-[2-[(E)-2-(1,3-benzoxazol-2-yl)ethenyl]-6-chlorophenoxy]-N,N-dipropylbutan-1-amine has a molecular weight of 426.99 g/mol, XLogP of 6.93, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[(E)-2-(1,3-benzoxazol-2-yl)ethenyl]-6-chlorophenoxy]-N,N-dipropylbutan-1-amine is sourced from PubChem (CID 18435645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).