About 8-benzyl-3,7-dihydropurine-2,6-dione
8-benzyl-3,7-dihydropurine-2,6-dione (PubChem CID 18435695) has the molecular formula C12H10N4O2
and a molecular weight of 242.24 g/mol. Its IUPAC name is 8-benzyl-3,7-dihydropurine-2,6-dione.
Molecular Properties
| Compound Name | 8-benzyl-3,7-dihydropurine-2,6-dione |
| PubChem CID | 18435695 |
| Molecular Formula | C12H10N4O2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 8-benzyl-3,7-dihydropurine-2,6-dione |
| SMILES | O=c1[nH]c(=O)c2[nH]c(Cc3ccccc3)nc2[nH]1 |
| InChI | InChI=1S/C12H10N4O2/c17-11-9-10(15-12(18)16-11)14-8(13-9)6-7-4-2-1-3-5-7/h1-5H,6H2,(H3,13,14,15,16,17,18) |
| InChIKey | ARLSKSAJKBBXPV-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-benzyl-3,7-dihydropurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-benzyl-3,7-dihydropurine-2,6-dione?
The IUPAC name of 8-benzyl-3,7-dihydropurine-2,6-dione (CID 18435695) is 8-benzyl-3,7-dihydropurine-2,6-dione.
What is the SMILES notation for 8-benzyl-3,7-dihydropurine-2,6-dione?
The canonical SMILES for 8-benzyl-3,7-dihydropurine-2,6-dione is O=c1[nH]c(=O)c2[nH]c(Cc3ccccc3)nc2[nH]1.
What is the InChIKey of 8-benzyl-3,7-dihydropurine-2,6-dione?
The InChIKey is ARLSKSAJKBBXPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N4O2/c17-11-9-10(15-12(18)16-11)14-8(13-9)6-7-4-2-1-3-5-7/h1-5H,6H2,(H3,13,14,15,16,17,18).
What are the key properties of 8-benzyl-3,7-dihydropurine-2,6-dione?
8-benzyl-3,7-dihydropurine-2,6-dione has a molecular weight of 242.24 g/mol, XLogP of 0.53, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-benzyl-3,7-dihydropurine-2,6-dione is sourced from PubChem (CID 18435695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).