C33H36N4O3 — CID 18435783
3-[3-(1-methyl-2-oxospiro[indole-3,4'-piperidine]-1'-yl)propyl]-5,5-bis(4-methylphenyl)imidazolidine-2,4-dione (PubChem CID 18435783) has the molecular formula C33H36N4O3 and a molecular weight of 536.68 g/mol. Its IUPAC name is 3-[3-(1-methyl-2-oxospiro[indole-3,4'-piperidine]-1'-yl)propyl]-5,5-bis(4-methylphenyl)imidazolidine-2,4-dione.
| Compound Name | 3-[3-(1-methyl-2-oxospiro[indole-3,4'-piperidine]-1'-yl)propyl]-5,5-bis(4-methylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 18435783 |
| Molecular Formula | C33H36N4O3 |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.28 |
| IUPAC Name | 3-[3-(1-methyl-2-oxospiro[indole-3,4'-piperidine]-1'-yl)propyl]-5,5-bis(4-methylphenyl)imidazolidine-2,4-dione |
| SMILES | Cc1ccc(C2(c3ccc(C)cc3)NC(=O)N(CCCN3CCC4(CC3)C(=O)N(C)c3ccccc34)C2=O)cc1 |
| InChI | InChI=1S/C33H36N4O3/c1-23-9-13-25(14-10-23)33(26-15-11-24(2)12-16-26)30(39)37(31(40)34-33)20-6-19-36-21-17-32(18-22-36)27-7-4-5-8-28(27)35(3)29(32)38/h4-5,7-16H,6,17-22H2,1-3H3,(H,34,40) |
| InChIKey | PPEHXCFRMOUHLQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|